C22H16O6 — CID 127044661
2-(2-benzyl-4,5-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 127044661) has the molecular formula C22H16O6 and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-(2-benzyl-4,5-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 2-(2-benzyl-4,5-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 127044661 |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-(2-benzyl-4,5-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | O=c1cc(-c2cc(O)c(O)cc2Cc2ccccc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C22H16O6/c23-14-8-18(26)22-19(27)11-20(28-21(22)9-14)15-10-17(25)16(24)7-13(15)6-12-4-2-1-3-5-12/h1-5,7-11,23-26H,6H2 |
| InChIKey | YZHNQMGHXBKYIT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|