C23H20N4O7 — CID 129098991
5,6,7-trihydroxy-2-phenylchromen-4-one;1,3,7-trimethylpurine-2,6-dione (PubChem CID 129098991) has the molecular formula C23H20N4O7 and a molecular weight of 464.43 g/mol. Its IUPAC name is 5,6,7-trihydroxy-2-phenylchromen-4-one;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 5,6,7-trihydroxy-2-phenylchromen-4-one;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 129098991 |
| Molecular Formula | C23H20N4O7 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 5,6,7-trihydroxy-2-phenylchromen-4-one;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/C15H10O5.C8H10N4O2/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h1-7,17-19H;4H,1-3H3 |
| InChIKey | BOTMURCCSRMRQZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|