C22H19NO9 — CID 71483702
[4-(6-acetyloxy-5,7-dihydroxy-4-oxochromen-2-yl)phenyl] morpholine-4-carboxylate (PubChem CID 71483702) has the molecular formula C22H19NO9 and a molecular weight of 441.39 g/mol. Its IUPAC name is [4-(6-acetyloxy-5,7-dihydroxy-4-oxochromen-2-yl)phenyl] morpholine-4-carboxylate.
| Compound Name | [4-(6-acetyloxy-5,7-dihydroxy-4-oxochromen-2-yl)phenyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 71483702 |
| Molecular Formula | C22H19NO9 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [4-(6-acetyloxy-5,7-dihydroxy-4-oxochromen-2-yl)phenyl] morpholine-4-carboxylate |
| SMILES | CC(=O)Oc1c(O)cc2oc(-c3ccc(OC(=O)N4CCOCC4)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C22H19NO9/c1-12(24)30-21-16(26)11-18-19(20(21)27)15(25)10-17(32-18)13-2-4-14(5-3-13)31-22(28)23-6-8-29-9-7-23/h2-5,10-11,26-27H,6-9H2,1H3 |
| InChIKey | AQHRHPFPRYEFNK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|