C28H25ClN2O4 — CID 22264734
5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-2-phenylchromen-4-one (PubChem CID 22264734) has the molecular formula C28H25ClN2O4 and a molecular weight of 488.97 g/mol. Its IUPAC name is 5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-2-phenylchromen-4-one.
| Compound Name | 5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 22264734 |
| Molecular Formula | C28H25ClN2O4 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-2-phenylchromen-4-one |
| SMILES | O=C(COc1cccc2oc(-c3ccccc3)cc(=O)c12)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H25ClN2O4/c29-22-11-9-20(10-12-22)18-30-13-15-31(16-14-30)27(33)19-34-24-7-4-8-25-28(24)23(32)17-26(35-25)21-5-2-1-3-6-21/h1-12,17H,13-16,18-19H2 |
| InChIKey | FNECKLVSDJQYFC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |