C22H25ClN2O4 — CID 22264628
ethyl 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzoate (PubChem CID 22264628) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is ethyl 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzoate.
| Compound Name | ethyl 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 22264628 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | ethyl 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1OCC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O4/c1-2-28-22(27)19-5-3-4-6-20(19)29-16-21(26)25-13-11-24(12-14-25)15-17-7-9-18(23)10-8-17/h3-10H,2,11-16H2,1H3 |
| InChIKey | ISVOCZDWDHPKHV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |