C20H20ClFN2O4 — CID 22264040
2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-6-fluorobenzoic acid (PubChem CID 22264040) has the molecular formula C20H20ClFN2O4 and a molecular weight of 406.84 g/mol. Its IUPAC name is 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-6-fluorobenzoic acid.
| Compound Name | 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 22264040 |
| Molecular Formula | C20H20ClFN2O4 |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)cccc1OCC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H20ClFN2O4/c21-15-6-4-14(5-7-15)12-23-8-10-24(11-9-23)18(25)13-28-17-3-1-2-16(22)19(17)20(26)27/h1-7H,8-13H2,(H,26,27) |
| InChIKey | FURIRYKYGCPWJD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |