C19H24N2O4 — CID 87008929
1-[1-(4-methylphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 87008929) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[1-(4-methylphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 87008929 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[1-(4-methylphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NC(C)c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H24N2O4/c1-12-6-8-14(9-7-12)13(2)20-19(22)21-15-10-16(23-3)18(25-5)17(11-15)24-4/h6-11,13H,1-5H3,(H2,20,21,22) |
| InChIKey | PTCWGRBEGFSYAE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |