C17H18F2N2O4S — CID 87035526
1-(3,5-difluoro-4-methoxyphenyl)-3-[1-(4-methylsulfonylphenyl)ethyl]urea (PubChem CID 87035526) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-methoxyphenyl)-3-[1-(4-methylsulfonylphenyl)ethyl]urea.
| Compound Name | 1-(3,5-difluoro-4-methoxyphenyl)-3-[1-(4-methylsulfonylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 87035526 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-(3,5-difluoro-4-methoxyphenyl)-3-[1-(4-methylsulfonylphenyl)ethyl]urea |
| SMILES | COc1c(F)cc(NC(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C17H18F2N2O4S/c1-10(11-4-6-13(7-5-11)26(3,23)24)20-17(22)21-12-8-14(18)16(25-2)15(19)9-12/h4-10H,1-3H3,(H2,20,21,22) |
| InChIKey | RUNZKZNDPWHVRV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |