C18H22N2O4 — CID 108869400
1-(3,5-dimethoxyphenyl)-3-[1-(4-methoxyphenyl)ethyl]urea (PubChem CID 108869400) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[1-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[1-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108869400 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[1-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)Nc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-12(13-5-7-15(22-2)8-6-13)19-18(21)20-14-9-16(23-3)11-17(10-14)24-4/h5-12H,1-4H3,(H2,19,20,21) |
| InChIKey | UFGRYJSDOGIUNF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |