C13H18N2O5 — CID 5151052
methyl 2-[(3,5-dimethoxyphenyl)carbamoylamino]propanoate (PubChem CID 5151052) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethoxyphenyl)carbamoylamino]propanoate.
| Compound Name | methyl 2-[(3,5-dimethoxyphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 5151052 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 2-[(3,5-dimethoxyphenyl)carbamoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H18N2O5/c1-8(12(16)20-4)14-13(17)15-9-5-10(18-2)7-11(6-9)19-3/h5-8H,1-4H3,(H2,14,15,17) |
| InChIKey | ZLDUTCODDIGABO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |