C16H20N4O4 — CID 126817252
1-pyridazin-4-yl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 126817252) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-pyridazin-4-yl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-pyridazin-4-yl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 126817252 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-pyridazin-4-yl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | COc1cc(C(C)NC(=O)Nc2ccnnc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H20N4O4/c1-10(19-16(21)20-12-5-6-17-18-9-12)11-7-13(22-2)15(24-4)14(8-11)23-3/h5-10H,1-4H3,(H2,17,19,20,21) |
| InChIKey | XJFLHVRWCANUEP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |