C13H15FN4O2 — CID 94038782
1-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 94038782) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 94038782 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | COc1ccc([C@H](C)NC(=O)Nc2cn[nH]c2)cc1F |
| InChI | InChI=1S/C13H15FN4O2/c1-8(9-3-4-12(20-2)11(14)5-9)17-13(19)18-10-6-15-16-7-10/h3-8H,1-2H3,(H,15,16)(H2,17,18,19)/t8-/m0/s1 |
| InChIKey | UWQAAFTWVQJKEW-QMMMGPOBSA-N |
| XLogP | 2.44 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |