C20H23FN2O5 — CID 99783927
ethyl 2-[4-[[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]carbamoylamino]phenoxy]acetate (PubChem CID 99783927) has the molecular formula C20H23FN2O5 and a molecular weight of 390.41 g/mol. Its IUPAC name is ethyl 2-[4-[[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]carbamoylamino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]carbamoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 99783927 |
| Molecular Formula | C20H23FN2O5 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | ethyl 2-[4-[[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]carbamoylamino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(=O)N[C@H](C)c2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C20H23FN2O5/c1-4-27-19(24)12-28-16-8-6-15(7-9-16)23-20(25)22-13(2)14-5-10-18(26-3)17(21)11-14/h5-11,13H,4,12H2,1-3H3,(H2,22,23,25)/t13-/m1/s1 |
| InChIKey | VONDEHUPRVVCGL-CYBMUJFWSA-N |
| XLogP | 3.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |