C23H28N2O4 — CID 109056122
3-N-cycloheptyl-1-N-(2,5-dimethoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 109056122) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-N-cycloheptyl-1-N-(2,5-dimethoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-cycloheptyl-1-N-(2,5-dimethoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109056122 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-N-cycloheptyl-1-N-(2,5-dimethoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(C(=O)NC3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-28-19-12-13-21(29-2)20(15-19)25-23(27)17-9-7-8-16(14-17)22(26)24-18-10-5-3-4-6-11-18/h7-9,12-15,18H,3-6,10-11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | FCUZGTJUMWWYMX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |