C20H21ClF2N2O4 — CID 139384600
benzyl (2R)-2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoate (PubChem CID 139384600) has the molecular formula C20H21ClF2N2O4 and a molecular weight of 426.85 g/mol. Its IUPAC name is benzyl (2R)-2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoate.
| Compound Name | benzyl (2R)-2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoate |
|---|---|
| PubChem CID | 139384600 |
| Molecular Formula | C20H21ClF2N2O4 |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | benzyl (2R)-2-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoate |
| SMILES | CC[C@@](C)(NC(=O)Nc1ccc(OC(F)F)c(Cl)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21ClF2N2O4/c1-3-20(2,17(26)28-12-13-7-5-4-6-8-13)25-19(27)24-14-9-10-16(15(21)11-14)29-18(22)23/h4-11,18H,3,12H2,1-2H3,(H2,24,25,27)/t20-/m1/s1 |
| InChIKey | NGGMZRHOXKPBBF-HXUWFJFHSA-N |
| XLogP | 4.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |