C22H21ClN2O4S — CID 26682667
N-[2-chloro-5-[(2,5-diethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 26682667) has the molecular formula C22H21ClN2O4S and a molecular weight of 444.94 g/mol. Its IUPAC name is N-[2-chloro-5-[(2,5-diethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[(2,5-diethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26682667 |
| Molecular Formula | C22H21ClN2O4S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-[2-chloro-5-[(2,5-diethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)c2ccc(Cl)c(NC(=O)c3cccs3)c2)c1 |
| InChI | InChI=1S/C22H21ClN2O4S/c1-3-28-15-8-10-19(29-4-2)18(13-15)25-21(26)14-7-9-16(23)17(12-14)24-22(27)20-6-5-11-30-20/h5-13H,3-4H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | OPAONRWHBQHWNV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |