C24H25ClN2O3S — CID 55869328
N-[5-[2-(4-butoxyphenyl)ethylcarbamoyl]-2-chlorophenyl]thiophene-2-carboxamide (PubChem CID 55869328) has the molecular formula C24H25ClN2O3S and a molecular weight of 457.00 g/mol. Its IUPAC name is N-[5-[2-(4-butoxyphenyl)ethylcarbamoyl]-2-chlorophenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[2-(4-butoxyphenyl)ethylcarbamoyl]-2-chlorophenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55869328 |
| Molecular Formula | C24H25ClN2O3S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[5-[2-(4-butoxyphenyl)ethylcarbamoyl]-2-chlorophenyl]thiophene-2-carboxamide |
| SMILES | CCCCOc1ccc(CCNC(=O)c2ccc(Cl)c(NC(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C24H25ClN2O3S/c1-2-3-14-30-19-9-6-17(7-10-19)12-13-26-23(28)18-8-11-20(25)21(16-18)27-24(29)22-5-4-15-31-22/h4-11,15-16H,2-3,12-14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | FEKCCNYLPIBRQS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|