C18H19ClF3N3O2S — CID 55720301
N-[2-chloro-5-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 55720301) has the molecular formula C18H19ClF3N3O2S and a molecular weight of 433.88 g/mol. Its IUPAC name is N-[2-chloro-5-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55720301 |
| Molecular Formula | C18H19ClF3N3O2S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[2-chloro-5-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc(Cl)c(NC(=O)c2cccs2)c1)CC(F)(F)F |
| InChI | InChI=1S/C18H19ClF3N3O2S/c1-25(11-18(20,21)22)8-3-7-23-16(26)12-5-6-13(19)14(10-12)24-17(27)15-4-2-9-28-15/h2,4-6,9-10H,3,7-8,11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | PIHHYZLJZOATOT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|