C22H28N4O4 — CID 23857785
N-[4-(cyclohexanecarbonylamino)-2,5-diethoxyphenyl]pyrazine-2-carboxamide (PubChem CID 23857785) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-(cyclohexanecarbonylamino)-2,5-diethoxyphenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(cyclohexanecarbonylamino)-2,5-diethoxyphenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 23857785 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[4-(cyclohexanecarbonylamino)-2,5-diethoxyphenyl]pyrazine-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)C2CCCCC2)c(OCC)cc1NC(=O)c1cnccn1 |
| InChI | InChI=1S/C22H28N4O4/c1-3-29-19-13-17(26-22(28)18-14-23-10-11-24-18)20(30-4-2)12-16(19)25-21(27)15-8-6-5-7-9-15/h10-15H,3-9H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | DCYFVSWMRKNBJH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |