C16H17N7O3 — CID 647090
N-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 647090) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 647090 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | CCOc1cc(-n2cnnn2)c(OCC)cc1NC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H17N7O3/c1-3-25-14-8-13(23-10-19-21-22-23)15(26-4-2)7-11(14)20-16(24)12-9-17-5-6-18-12/h5-10H,3-4H2,1-2H3,(H,20,24) |
| InChIKey | KELIMBSNWJDVEH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |