About [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate
[4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate (PubChem CID 16551468) has the molecular formula C12H8N6O2
and a molecular weight of 268.24 g/mol. Its IUPAC name is [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate |
| PubChem CID | 16551468 |
| Molecular Formula | C12H8N6O2 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate |
| SMILES | O=C(Oc1ccc(-n2cnnn2)cc1)c1cnccn1 |
| InChI | InChI=1S/C12H8N6O2/c19-12(11-7-13-5-6-14-11)20-10-3-1-9(2-4-10)18-8-15-16-17-18/h1-8H |
| InChIKey | AONLHPQBMXSCPO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate?
The IUPAC name of [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate (CID 16551468) is [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate.
What is the SMILES notation for [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate?
The canonical SMILES for [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate is O=C(Oc1ccc(-n2cnnn2)cc1)c1cnccn1.
What is the InChIKey of [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate?
The InChIKey is AONLHPQBMXSCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N6O2/c19-12(11-7-13-5-6-14-11)20-10-3-1-9(2-4-10)18-8-15-16-17-18/h1-8H.
What are the key properties of [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate?
[4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate has a molecular weight of 268.24 g/mol, XLogP of 0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(tetrazol-1-yl)phenyl] pyrazine-2-carboxylate is sourced from PubChem (CID 16551468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).