C29H40N2O4 — CID 3186773
4-tert-butyl-N-[4-[(2-cyclohexylacetyl)amino]-2,5-diethoxyphenyl]benzamide (PubChem CID 3186773) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[(2-cyclohexylacetyl)amino]-2,5-diethoxyphenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[(2-cyclohexylacetyl)amino]-2,5-diethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 3186773 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 4-tert-butyl-N-[4-[(2-cyclohexylacetyl)amino]-2,5-diethoxyphenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccc(C(C)(C)C)cc2)c(OCC)cc1NC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C29H40N2O4/c1-6-34-25-19-24(31-28(33)21-13-15-22(16-14-21)29(3,4)5)26(35-7-2)18-23(25)30-27(32)17-20-11-9-8-10-12-20/h13-16,18-20H,6-12,17H2,1-5H3,(H,30,32)(H,31,33) |
| InChIKey | BDUUFYZZMCEWFQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |