C19H22N2O7 — CID 3186760
ethyl 2-[2,5-diethoxy-4-(furan-2-carbonylamino)anilino]-2-oxoacetate (PubChem CID 3186760) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is ethyl 2-[2,5-diethoxy-4-(furan-2-carbonylamino)anilino]-2-oxoacetate.
| Compound Name | ethyl 2-[2,5-diethoxy-4-(furan-2-carbonylamino)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 3186760 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | ethyl 2-[2,5-diethoxy-4-(furan-2-carbonylamino)anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(OCC)c(NC(=O)c2ccco2)cc1OCC |
| InChI | InChI=1S/C19H22N2O7/c1-4-25-15-11-13(21-18(23)19(24)27-6-3)16(26-5-2)10-12(15)20-17(22)14-8-7-9-28-14/h7-11H,4-6H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | JPGKLCDBWMMDTK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|