C23H24N2O8S — CID 1138763
methyl 4-[[2,5-diethoxy-4-(furan-2-carbonylamino)phenyl]sulfamoyl]benzoate (PubChem CID 1138763) has the molecular formula C23H24N2O8S and a molecular weight of 488.52 g/mol. Its IUPAC name is methyl 4-[[2,5-diethoxy-4-(furan-2-carbonylamino)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[2,5-diethoxy-4-(furan-2-carbonylamino)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 1138763 |
| Molecular Formula | C23H24N2O8S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | methyl 4-[[2,5-diethoxy-4-(furan-2-carbonylamino)phenyl]sulfamoyl]benzoate |
| SMILES | CCOc1cc(NS(=O)(=O)c2ccc(C(=O)OC)cc2)c(OCC)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C23H24N2O8S/c1-4-31-20-14-18(25-34(28,29)16-10-8-15(9-11-16)23(27)30-3)21(32-5-2)13-17(20)24-22(26)19-7-6-12-33-19/h6-14,25H,4-5H2,1-3H3,(H,24,26) |
| InChIKey | PUUMIOOCLZPVRU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |