C21H20BrN3O6S2 — CID 4603438
N-[[5-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 4603438) has the molecular formula C21H20BrN3O6S2 and a molecular weight of 554.44 g/mol. Its IUPAC name is N-[[5-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[5-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4603438 |
| Molecular Formula | C21H20BrN3O6S2 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | N-[[5-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(OC)c(NC(=S)NC(=O)c3ccco3)c2)cc1Br |
| InChI | InChI=1S/C21H20BrN3O6S2/c1-3-30-17-8-6-13(11-15(17)22)25-33(27,28)14-7-9-18(29-2)16(12-14)23-21(32)24-20(26)19-5-4-10-31-19/h4-12,25H,3H2,1-2H3,(H2,23,24,26,32) |
| InChIKey | QJZKKLCEVKUVOE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|