C24H25N3O5S — CID 3934658
N-[3-[(3-butoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide (PubChem CID 3934658) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[3-[(3-butoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(3-butoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3934658 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[3-[(3-butoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2cc(NC(=O)c3ccco3)ccc2OC)c1 |
| InChI | InChI=1S/C24H25N3O5S/c1-3-4-12-31-18-8-5-7-16(14-18)22(28)27-24(33)26-19-15-17(10-11-20(19)30-2)25-23(29)21-9-6-13-32-21/h5-11,13-15H,3-4,12H2,1-2H3,(H,25,29)(H2,26,27,28,33) |
| InChIKey | NYYJUPFXERLAKE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|