C13H15N3O4 — CID 71807610
N-(2,4-diethoxypyrimidin-5-yl)furan-2-carboxamide (PubChem CID 71807610) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(2,4-diethoxypyrimidin-5-yl)furan-2-carboxamide.
| Compound Name | N-(2,4-diethoxypyrimidin-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71807610 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(2,4-diethoxypyrimidin-5-yl)furan-2-carboxamide |
| SMILES | CCOc1ncc(NC(=O)c2ccco2)c(OCC)n1 |
| InChI | InChI=1S/C13H15N3O4/c1-3-18-12-9(8-14-13(16-12)19-4-2)15-11(17)10-6-5-7-20-10/h5-8H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | YGBBLSNEUWSRNA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |