C20H23N3O4S — CID 56568185
methyl 2-[3-[2-methyl-5-(phenylcarbamoylamino)anilino]-3-oxopropyl]sulfanylacetate (PubChem CID 56568185) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is methyl 2-[3-[2-methyl-5-(phenylcarbamoylamino)anilino]-3-oxopropyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[2-methyl-5-(phenylcarbamoylamino)anilino]-3-oxopropyl]sulfanylacetate |
|---|---|
| PubChem CID | 56568185 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | methyl 2-[3-[2-methyl-5-(phenylcarbamoylamino)anilino]-3-oxopropyl]sulfanylacetate |
| SMILES | COC(=O)CSCCC(=O)Nc1cc(NC(=O)Nc2ccccc2)ccc1C |
| InChI | InChI=1S/C20H23N3O4S/c1-14-8-9-16(22-20(26)21-15-6-4-3-5-7-15)12-17(14)23-18(24)10-11-28-13-19(25)27-2/h3-9,12H,10-11,13H2,1-2H3,(H,23,24)(H2,21,22,26) |
| InChIKey | XQPYQGHKINVKTP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|