C12H16BrF2NO2S — CID 106723891
4-bromo-N-(2-tert-butylsulfonylethyl)-2,6-difluoroaniline (PubChem CID 106723891) has the molecular formula C12H16BrF2NO2S and a molecular weight of 356.23 g/mol. Its IUPAC name is 4-bromo-N-(2-tert-butylsulfonylethyl)-2,6-difluoroaniline.
| Compound Name | 4-bromo-N-(2-tert-butylsulfonylethyl)-2,6-difluoroaniline |
|---|---|
| PubChem CID | 106723891 |
| Molecular Formula | C12H16BrF2NO2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 4-bromo-N-(2-tert-butylsulfonylethyl)-2,6-difluoroaniline |
| SMILES | CC(C)(C)S(=O)(=O)CCNc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H16BrF2NO2S/c1-12(2,3)19(17,18)5-4-16-11-9(14)6-8(13)7-10(11)15/h6-7,16H,4-5H2,1-3H3 |
| InChIKey | YARNUSIZDXGLSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |