C8H4BrF2NO — CID 91658316
2-(4-bromo-2,5-difluorophenoxy)acetonitrile (PubChem CID 91658316) has the molecular formula C8H4BrF2NO and a molecular weight of 248.03 g/mol. Its IUPAC name is 2-(4-bromo-2,5-difluorophenoxy)acetonitrile.
| Compound Name | 2-(4-bromo-2,5-difluorophenoxy)acetonitrile |
|---|---|
| PubChem CID | 91658316 |
| Molecular Formula | C8H4BrF2NO |
| Molecular Weight | 248.03 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 2-(4-bromo-2,5-difluorophenoxy)acetonitrile |
| SMILES | N#CCOc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C8H4BrF2NO/c9-5-3-7(11)8(4-6(5)10)13-2-1-12/h3-4H,2H2 |
| InChIKey | GAPMBTCSUWWWDI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.03 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|