C9H8BrF3O — CID 10890898
1-(3-bromopropoxy)-2,4,5-trifluorobenzene (PubChem CID 10890898) has the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. Its IUPAC name is 1-(3-bromopropoxy)-2,4,5-trifluorobenzene.
| Compound Name | 1-(3-bromopropoxy)-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 10890898 |
| Molecular Formula | C9H8BrF3O |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 1-(3-bromopropoxy)-2,4,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(OCCCBr)cc1F |
| InChI | InChI=1S/C9H8BrF3O/c10-2-1-3-14-9-5-7(12)6(11)4-8(9)13/h4-5H,1-3H2 |
| InChIKey | PPQKEUZHFSZNCD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|