C8H5BrF4O — CID 54074008
1-(2-bromoethoxy)-2,3,4,5-tetrafluorobenzene (PubChem CID 54074008) has the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. Its IUPAC name is 1-(2-bromoethoxy)-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-(2-bromoethoxy)-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 54074008 |
| Molecular Formula | C8H5BrF4O |
| Molecular Weight | 273.02 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | 1-(2-bromoethoxy)-2,3,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(OCCBr)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5BrF4O/c9-1-2-14-5-3-4(10)6(11)8(13)7(5)12/h3H,1-2H2 |
| InChIKey | MIKXLVDYRBRJLC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.02 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|