C12H14Br2I2O2 — CID 66664651
1,4-bis(3-bromopropoxy)-2,5-diiodobenzene (PubChem CID 66664651) has the molecular formula C12H14Br2I2O2 and a molecular weight of 603.86 g/mol. Its IUPAC name is 1,4-bis(3-bromopropoxy)-2,5-diiodobenzene.
| Compound Name | 1,4-bis(3-bromopropoxy)-2,5-diiodobenzene |
|---|---|
| PubChem CID | 66664651 |
| Molecular Formula | C12H14Br2I2O2 |
| Molecular Weight | 603.86 g/mol |
| Exact Mass | 601.74 |
| IUPAC Name | 1,4-bis(3-bromopropoxy)-2,5-diiodobenzene |
| SMILES | BrCCCOc1cc(I)c(OCCCBr)cc1I |
| InChI | InChI=1S/C12H14Br2I2O2/c13-3-1-5-17-11-7-10(16)12(8-9(11)15)18-6-2-4-14/h7-8H,1-6H2 |
| InChIKey | LKWXSOYZZOPHLZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|