About 1-decoxy-2,5-diiodo-4-methylbenzene
1-decoxy-2,5-diiodo-4-methylbenzene (PubChem CID 70847415) has the molecular formula C17H26I2O
and a molecular weight of 500.20 g/mol. Its IUPAC name is 1-decoxy-2,5-diiodo-4-methylbenzene.
Molecular Properties
| Compound Name | 1-decoxy-2,5-diiodo-4-methylbenzene |
| PubChem CID | 70847415 |
| Molecular Formula | C17H26I2O |
| Molecular Weight | 500.20 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 1-decoxy-2,5-diiodo-4-methylbenzene |
| SMILES | CCCCCCCCCCOc1cc(I)c(C)cc1I |
| InChI | InChI=1S/C17H26I2O/c1-3-4-5-6-7-8-9-10-11-20-17-13-15(18)14(2)12-16(17)19/h12-13H,3-11H2,1-2H3 |
| InChIKey | OCYBNMIPPQOTEL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.20 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-decoxy-2,5-diiodo-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decoxy-2,5-diiodo-4-methylbenzene?
The IUPAC name of 1-decoxy-2,5-diiodo-4-methylbenzene (CID 70847415) is 1-decoxy-2,5-diiodo-4-methylbenzene.
What is the SMILES notation for 1-decoxy-2,5-diiodo-4-methylbenzene?
The canonical SMILES for 1-decoxy-2,5-diiodo-4-methylbenzene is CCCCCCCCCCOc1cc(I)c(C)cc1I.
What is the InChIKey of 1-decoxy-2,5-diiodo-4-methylbenzene?
The InChIKey is OCYBNMIPPQOTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26I2O/c1-3-4-5-6-7-8-9-10-11-20-17-13-15(18)14(2)12-16(17)19/h12-13H,3-11H2,1-2H3.
What are the key properties of 1-decoxy-2,5-diiodo-4-methylbenzene?
1-decoxy-2,5-diiodo-4-methylbenzene has a molecular weight of 500.20 g/mol, XLogP of 6.72, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decoxy-2,5-diiodo-4-methylbenzene is sourced from PubChem (CID 70847415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).