About 3-iodo-4-octoxyaniline
3-iodo-4-octoxyaniline (PubChem CID 66093383) has the molecular formula C14H22INO
and a molecular weight of 347.24 g/mol. Its IUPAC name is 3-iodo-4-octoxyaniline.
Molecular Properties
| Compound Name | 3-iodo-4-octoxyaniline |
| PubChem CID | 66093383 |
| Molecular Formula | C14H22INO |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-iodo-4-octoxyaniline |
| SMILES | CCCCCCCCOc1ccc(N)cc1I |
| InChI | InChI=1S/C14H22INO/c1-2-3-4-5-6-7-10-17-14-9-8-12(16)11-13(14)15/h8-9,11H,2-7,10,16H2,1H3 |
| InChIKey | GUCKZEABKJYXAP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-octoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-octoxyaniline?
The IUPAC name of 3-iodo-4-octoxyaniline (CID 66093383) is 3-iodo-4-octoxyaniline.
What is the SMILES notation for 3-iodo-4-octoxyaniline?
The canonical SMILES for 3-iodo-4-octoxyaniline is CCCCCCCCOc1ccc(N)cc1I.
What is the InChIKey of 3-iodo-4-octoxyaniline?
The InChIKey is GUCKZEABKJYXAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22INO/c1-2-3-4-5-6-7-10-17-14-9-8-12(16)11-13(14)15/h8-9,11H,2-7,10,16H2,1H3.
What are the key properties of 3-iodo-4-octoxyaniline?
3-iodo-4-octoxyaniline has a molecular weight of 347.24 g/mol, XLogP of 4.61, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-octoxyaniline is sourced from PubChem (CID 66093383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).