About 4-bromo-3-heptoxyaniline
4-bromo-3-heptoxyaniline (PubChem CID 103008551) has the molecular formula C13H20BrNO
and a molecular weight of 286.21 g/mol. Its IUPAC name is 4-bromo-3-heptoxyaniline.
Molecular Properties
| Compound Name | 4-bromo-3-heptoxyaniline |
| PubChem CID | 103008551 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-bromo-3-heptoxyaniline |
| SMILES | CCCCCCCOc1cc(N)ccc1Br |
| InChI | InChI=1S/C13H20BrNO/c1-2-3-4-5-6-9-16-13-10-11(15)7-8-12(13)14/h7-8,10H,2-6,9,15H2,1H3 |
| InChIKey | AMOQBBQEBBEXKS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-heptoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-heptoxyaniline?
The IUPAC name of 4-bromo-3-heptoxyaniline (CID 103008551) is 4-bromo-3-heptoxyaniline.
What is the SMILES notation for 4-bromo-3-heptoxyaniline?
The canonical SMILES for 4-bromo-3-heptoxyaniline is CCCCCCCOc1cc(N)ccc1Br.
What is the InChIKey of 4-bromo-3-heptoxyaniline?
The InChIKey is AMOQBBQEBBEXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrNO/c1-2-3-4-5-6-9-16-13-10-11(15)7-8-12(13)14/h7-8,10H,2-6,9,15H2,1H3.
What are the key properties of 4-bromo-3-heptoxyaniline?
4-bromo-3-heptoxyaniline has a molecular weight of 286.21 g/mol, XLogP of 4.38, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-heptoxyaniline is sourced from PubChem (CID 103008551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).