C28H44I2O12 — CID 101344499
1-[2-[2-[2-[2-[2,5-diiodo-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-one (PubChem CID 101344499) has the molecular formula C28H44I2O12 and a molecular weight of 826.46 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[2,5-diiodo-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-one.
| Compound Name | 1-[2-[2-[2-[2-[2,5-diiodo-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-one |
|---|---|
| PubChem CID | 101344499 |
| Molecular Formula | C28H44I2O12 |
| Molecular Weight | 826.46 g/mol |
| Exact Mass | 826.09 |
| IUPAC Name | 1-[2-[2-[2-[2-[2,5-diiodo-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propan-2-one |
| SMILES | CC(=O)COCCOCCOCCOCCOc1cc(I)c(OCCOCCOCCOCCOCC(C)=O)cc1I |
| InChI | InChI=1S/C28H44I2O12/c1-23(31)21-39-13-11-35-5-3-33-7-9-37-15-17-41-27-19-26(30)28(20-25(27)29)42-18-16-38-10-8-34-4-6-36-12-14-40-22-24(2)32/h19-20H,3-18,21-22H2,1-2H3 |
| InChIKey | HCBSMUHFLWPPLD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|