C18H26F2 — CID 18610847
1-[2-(4-butylcyclohexyl)ethyl]-2,4-difluorobenzene (PubChem CID 18610847) has the molecular formula C18H26F2 and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-[2-(4-butylcyclohexyl)ethyl]-2,4-difluorobenzene.
| Compound Name | 1-[2-(4-butylcyclohexyl)ethyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 18610847 |
| Molecular Formula | C18H26F2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[2-(4-butylcyclohexyl)ethyl]-2,4-difluorobenzene |
| SMILES | CCCCC1CCC(CCc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H26F2/c1-2-3-4-14-5-7-15(8-6-14)9-10-16-11-12-17(19)13-18(16)20/h11-15H,2-10H2,1H3 |
| InChIKey | FCSAMEGVEAYFBQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |