C21H20F2N2O3S — CID 46575754
N-(2,6-difluorophenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]propanamide (PubChem CID 46575754) has the molecular formula C21H20F2N2O3S and a molecular weight of 418.47 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]propanamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]propanamide |
|---|---|
| PubChem CID | 46575754 |
| Molecular Formula | C21H20F2N2O3S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanyl]propanamide |
| SMILES | CC(SCCCCN1C(=O)c2ccccc2C1=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C21H20F2N2O3S/c1-13(19(26)24-18-16(22)9-6-10-17(18)23)29-12-5-4-11-25-20(27)14-7-2-3-8-15(14)21(25)28/h2-3,6-10,13H,4-5,11-12H2,1H3,(H,24,26) |
| InChIKey | FNTHRQQVSGZXKN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|