C22H32FN3O6S — CID 153312076
N-[(1R)-1-(2,4-dioxoimidazolidin-1-yl)-1-[4-fluoro-3-(oxan-4-ylmethoxy)phenyl]ethyl]pentane-1-sulfonamide (PubChem CID 153312076) has the molecular formula C22H32FN3O6S and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dioxoimidazolidin-1-yl)-1-[4-fluoro-3-(oxan-4-ylmethoxy)phenyl]ethyl]pentane-1-sulfonamide.
| Compound Name | N-[(1R)-1-(2,4-dioxoimidazolidin-1-yl)-1-[4-fluoro-3-(oxan-4-ylmethoxy)phenyl]ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 153312076 |
| Molecular Formula | C22H32FN3O6S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[(1R)-1-(2,4-dioxoimidazolidin-1-yl)-1-[4-fluoro-3-(oxan-4-ylmethoxy)phenyl]ethyl]pentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)N[C@](C)(c1ccc(F)c(OCC2CCOCC2)c1)N1CC(=O)NC1=O |
| InChI | InChI=1S/C22H32FN3O6S/c1-3-4-5-12-33(29,30)25-22(2,26-14-20(27)24-21(26)28)17-6-7-18(23)19(13-17)32-15-16-8-10-31-11-9-16/h6-7,13,16,25H,3-5,8-12,14-15H2,1-2H3,(H,24,27,28)/t22-/m0/s1 |
| InChIKey | ZFPBFDFUQYZHIP-QFIPXVFZSA-N |
| XLogP | 2.47 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|