C13H19BrClNO3S — CID 116815789
N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-chlorobutane-1-sulfonamide (PubChem CID 116815789) has the molecular formula C13H19BrClNO3S and a molecular weight of 384.72 g/mol. Its IUPAC name is N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-chlorobutane-1-sulfonamide.
| Compound Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-chlorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 116815789 |
| Molecular Formula | C13H19BrClNO3S |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-chlorobutane-1-sulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)CCCCCl)cc1Br |
| InChI | InChI=1S/C13H19BrClNO3S/c1-10(16-20(17,18)8-4-3-7-15)11-5-6-13(19-2)12(14)9-11/h5-6,9-10,16H,3-4,7-8H2,1-2H3 |
| InChIKey | RRTZZRIYZUOQNP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|