C18H22BrNO5S — CID 55598938
N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 55598938) has the molecular formula C18H22BrNO5S and a molecular weight of 444.35 g/mol. Its IUPAC name is N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 55598938 |
| Molecular Formula | C18H22BrNO5S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)NC(C)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H22BrNO5S/c1-13(14-4-9-18(24-3)17(19)12-14)20-26(21,22)16-7-5-15(6-8-16)25-11-10-23-2/h4-9,12-13,20H,10-11H2,1-3H3 |
| InChIKey | RLQRABXBCLDKRY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|