C21H21NO2S — CID 25036786
1-phenyl-N-[1-(4-phenylphenyl)ethyl]methanesulfonamide (PubChem CID 25036786) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-phenyl-N-[1-(4-phenylphenyl)ethyl]methanesulfonamide.
| Compound Name | 1-phenyl-N-[1-(4-phenylphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 25036786 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-phenyl-N-[1-(4-phenylphenyl)ethyl]methanesulfonamide |
| SMILES | CC(NS(=O)(=O)Cc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO2S/c1-17(22-25(23,24)16-18-8-4-2-5-9-18)19-12-14-21(15-13-19)20-10-6-3-7-11-20/h2-15,17,22H,16H2,1H3 |
| InChIKey | ICIDXXNEINOBPB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |