C42H36N4O4S2 — CID 132551488
1-N,5-N-bis[(1R,2R)-2-(ethynylamino)-1,2-diphenylethyl]naphthalene-1,5-disulfonamide (PubChem CID 132551488) has the molecular formula C42H36N4O4S2 and a molecular weight of 724.91 g/mol. Its IUPAC name is 1-N,5-N-bis[(1R,2R)-2-(ethynylamino)-1,2-diphenylethyl]naphthalene-1,5-disulfonamide.
| Compound Name | 1-N,5-N-bis[(1R,2R)-2-(ethynylamino)-1,2-diphenylethyl]naphthalene-1,5-disulfonamide |
|---|---|
| PubChem CID | 132551488 |
| Molecular Formula | C42H36N4O4S2 |
| Molecular Weight | 724.91 g/mol |
| Exact Mass | 724.22 |
| IUPAC Name | 1-N,5-N-bis[(1R,2R)-2-(ethynylamino)-1,2-diphenylethyl]naphthalene-1,5-disulfonamide |
| SMILES | C#CN[C@H](c1ccccc1)[C@H](NS(=O)(=O)c1cccc2c(S(=O)(=O)N[C@H](c3ccccc3)[C@H](NC#C)c3ccccc3)cccc12)c1ccccc1 |
| InChI | InChI=1S/C42H36N4O4S2/c1-3-43-39(31-19-9-5-10-20-31)41(33-23-13-7-14-24-33)45-51(47,48)37-29-17-28-36-35(37)27-18-30-38(36)52(49,50)46-42(34-25-15-8-16-26-34)40(44-4-2)32-21-11-6-12-22-32/h1-2,5-30,39-46H/t39-,40-,41-,42-/m1/s1 |
| InChIKey | ATCYEYILWQOBOT-BMGLKWEPSA-N |
| XLogP | 6.72 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.91 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|