C16H18F3N3O4S — CID 137395408
[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino] 2,2,2-trifluoroacetate (PubChem CID 137395408) has the molecular formula C16H18F3N3O4S and a molecular weight of 405.40 g/mol. Its IUPAC name is [2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino] 2,2,2-trifluoroacetate.
| Compound Name | [2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137395408 |
| Molecular Formula | C16H18F3N3O4S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino] 2,2,2-trifluoroacetate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCNOC(=O)C(F)(F)F)cccc12 |
| InChI | InChI=1S/C16H18F3N3O4S/c1-22(2)13-7-3-6-12-11(13)5-4-8-14(12)27(24,25)21-10-9-20-26-15(23)16(17,18)19/h3-8,20-21H,9-10H2,1-2H3 |
| InChIKey | QWLCBMONMVWWBU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|