C32H39N5O4S — CID 58735342
N-[3-[2-[3-(4-amino-2-methylbenzo[g]benzimidazol-1-yl)propoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 58735342) has the molecular formula C32H39N5O4S and a molecular weight of 589.76 g/mol. Its IUPAC name is N-[3-[2-[3-(4-amino-2-methylbenzo[g]benzimidazol-1-yl)propoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[3-[2-[3-(4-amino-2-methylbenzo[g]benzimidazol-1-yl)propoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 58735342 |
| Molecular Formula | C32H39N5O4S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | N-[3-[2-[3-(4-amino-2-methylbenzo[g]benzimidazol-1-yl)propoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | Cc1nc2c(N)cc3ccccc3c2n1CCCOCCOCCCNS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C32H39N5O4S/c1-23-35-31-28(33)22-24-10-4-5-11-25(24)32(31)37(23)17-9-19-41-21-20-40-18-8-16-34-42(38,39)30-15-7-12-26-27(30)13-6-14-29(26)36(2)3/h4-7,10-15,22,34H,8-9,16-21,33H2,1-3H3 |
| InChIKey | QTTLGGULIKSLEG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|