C30H27N5O2S — CID 42634812
5-(dimethylamino)-N-[2-(2-quinolin-8-ylbenzimidazol-1-yl)ethyl]naphthalene-1-sulfonamide (PubChem CID 42634812) has the molecular formula C30H27N5O2S and a molecular weight of 521.65 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[2-(2-quinolin-8-ylbenzimidazol-1-yl)ethyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[2-(2-quinolin-8-ylbenzimidazol-1-yl)ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 42634812 |
| Molecular Formula | C30H27N5O2S |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 5-(dimethylamino)-N-[2-(2-quinolin-8-ylbenzimidazol-1-yl)ethyl]naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCn3c(-c4cccc5cccnc45)nc4ccccc43)cccc12 |
| InChI | InChI=1S/C30H27N5O2S/c1-34(2)26-16-6-12-23-22(26)11-7-17-28(23)38(36,37)32-19-20-35-27-15-4-3-14-25(27)33-30(35)24-13-5-9-21-10-8-18-31-29(21)24/h3-18,32H,19-20H2,1-2H3 |
| InChIKey | JAKQNWLBOJMBAH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |