C21H21Cl2N3Pt — CID 58251814
dichloroplatinum;8-[1-(3-methylbutyl)benzimidazol-2-yl]quinoline (PubChem CID 58251814) has the molecular formula C21H21Cl2N3Pt and a molecular weight of 581.40 g/mol. Its IUPAC name is dichloroplatinum;8-[1-(3-methylbutyl)benzimidazol-2-yl]quinoline.
| Compound Name | dichloroplatinum;8-[1-(3-methylbutyl)benzimidazol-2-yl]quinoline |
|---|---|
| PubChem CID | 58251814 |
| Molecular Formula | C21H21Cl2N3Pt |
| Molecular Weight | 581.40 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | dichloroplatinum;8-[1-(3-methylbutyl)benzimidazol-2-yl]quinoline |
| SMILES | CC(C)CCn1c(-c2cccc3cccnc23)nc2ccccc21.Cl[Pt]Cl |
| InChI | InChI=1S/C21H21N3.2ClH.Pt/c1-15(2)12-14-24-19-11-4-3-10-18(19)23-21(24)17-9-5-7-16-8-6-13-22-20(16)17;;;/h3-11,13,15H,12,14H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MYUXPWSGRJUWBA-UHFFFAOYSA-L |
| XLogP | 6.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.40 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |