About dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate
dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate (PubChem CID 58251826) has the molecular formula C18H13Cl2N3O2Pt
and a molecular weight of 569.31 g/mol. Its IUPAC name is dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate.
Molecular Properties
| Compound Name | dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate |
| PubChem CID | 58251826 |
| Molecular Formula | C18H13Cl2N3O2Pt |
| Molecular Weight | 569.31 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate |
| SMILES | Cl[Pt]Cl.O=COCn1c(-c2cccc3cccnc23)nc2ccccc21 |
| InChI | InChI=1S/C18H13N3O2.2ClH.Pt/c22-12-23-11-21-16-9-2-1-8-15(16)20-18(21)14-7-3-5-13-6-4-10-19-17(13)14;;;/h1-10,12H,11H2;2*1H;/q;;;+2/p-2 |
| InChIKey | FJXDCFAJDIQQNZ-UHFFFAOYSA-L |
| XLogP | 4.76 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate?
The IUPAC name of dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate (CID 58251826) is dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate.
What is the SMILES notation for dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate?
The canonical SMILES for dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate is Cl[Pt]Cl.O=COCn1c(-c2cccc3cccnc23)nc2ccccc21.
What is the InChIKey of dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate?
The InChIKey is FJXDCFAJDIQQNZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H13N3O2.2ClH.Pt/c22-12-23-11-21-16-9-2-1-8-15(16)20-18(21)14-7-3-5-13-6-4-10-19-17(13)14;;;/h1-10,12H,11H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate?
dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate has a molecular weight of 569.31 g/mol, XLogP of 4.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;(2-quinolin-8-ylbenzimidazol-1-yl)methyl formate is sourced from PubChem (CID 58251826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).