C27H23Cl3FN3OPt- — CID 58251828
carbanide;1-(4-fluorophenyl)-4-(2-quinolin-8-ylbenzimidazol-1-yl)butan-1-one;trichloroplatinum (PubChem CID 58251828) has the molecular formula C27H23Cl3FN3OPt- and a molecular weight of 725.94 g/mol. Its IUPAC name is carbanide;1-(4-fluorophenyl)-4-(2-quinolin-8-ylbenzimidazol-1-yl)butan-1-one;trichloroplatinum.
| Compound Name | carbanide;1-(4-fluorophenyl)-4-(2-quinolin-8-ylbenzimidazol-1-yl)butan-1-one;trichloroplatinum |
|---|---|
| PubChem CID | 58251828 |
| Molecular Formula | C27H23Cl3FN3OPt- |
| Molecular Weight | 725.94 g/mol |
| Exact Mass | 724.05 |
| IUPAC Name | carbanide;1-(4-fluorophenyl)-4-(2-quinolin-8-ylbenzimidazol-1-yl)butan-1-one;trichloroplatinum |
| SMILES | Cl[Pt](Cl)Cl.O=C(CCCn1c(-c2cccc3cccnc23)nc2ccccc21)c1ccc(F)cc1.[CH3-] |
| InChI | InChI=1S/C26H20FN3O.CH3.3ClH.Pt/c27-20-14-12-18(13-15-20)24(31)11-5-17-30-23-10-2-1-9-22(23)29-26(30)21-8-3-6-19-7-4-16-28-25(19)21;;;;;/h1-4,6-10,12-16H,5,11,17H2;1H3;3*1H;/q;-1;;;;+3/p-3 |
| InChIKey | ZCNANRLCEVFYJL-UHFFFAOYSA-K |
| XLogP | 8.57 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.94 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|